About 1,2-dihydroindeno[1,2-b]indole
1,2-dihydroindeno[1,2-b]indole (PubChem CID 69302209) has the molecular formula C15H11N
and a molecular weight of 205.26 g/mol. Its IUPAC name is 1,2-dihydroindeno[1,2-b]indole.
Molecular Properties
| Compound Name | 1,2-dihydroindeno[1,2-b]indole |
| PubChem CID | 69302209 |
| Molecular Formula | C15H11N |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 1,2-dihydroindeno[1,2-b]indole |
| SMILES | C1=CC2=C3N=c4ccccc4=C3C=C2CC1 |
| InChI | InChI=1S/C15H11N/c1-2-6-11-10(5-1)9-13-12-7-3-4-8-14(12)16-15(11)13/h2-4,6-9H,1,5H2 |
| InChIKey | AGYWLCLYUUCKJS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2-dihydroindeno[1,2-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydroindeno[1,2-b]indole?
The IUPAC name of 1,2-dihydroindeno[1,2-b]indole (CID 69302209) is 1,2-dihydroindeno[1,2-b]indole.
What is the SMILES notation for 1,2-dihydroindeno[1,2-b]indole?
The canonical SMILES for 1,2-dihydroindeno[1,2-b]indole is C1=CC2=C3N=c4ccccc4=C3C=C2CC1.
What is the InChIKey of 1,2-dihydroindeno[1,2-b]indole?
The InChIKey is AGYWLCLYUUCKJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N/c1-2-6-11-10(5-1)9-13-12-7-3-4-8-14(12)16-15(11)13/h2-4,6-9H,1,5H2.
What are the key properties of 1,2-dihydroindeno[1,2-b]indole?
1,2-dihydroindeno[1,2-b]indole has a molecular weight of 205.26 g/mol, XLogP of 2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydroindeno[1,2-b]indole is sourced from PubChem (CID 69302209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).