C23H33NO4 — CID 69302267
ethyl 2-[(3aS,3bR,9aR,9bR,11aS)-6,9a,11a-trimethyl-1,7-dioxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydroindeno[5,4-f]quinolin-2-yl]acetate (PubChem CID 69302267) has the molecular formula C23H33NO4 and a molecular weight of 387.52 g/mol. Its IUPAC name is ethyl 2-[(3aS,3bR,9aR,9bR,11aS)-6,9a,11a-trimethyl-1,7-dioxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydroindeno[5,4-f]quinolin-2-yl]acetate.
| Compound Name | ethyl 2-[(3aS,3bR,9aR,9bR,11aS)-6,9a,11a-trimethyl-1,7-dioxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydroindeno[5,4-f]quinolin-2-yl]acetate |
|---|---|
| PubChem CID | 69302267 |
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | ethyl 2-[(3aS,3bR,9aR,9bR,11aS)-6,9a,11a-trimethyl-1,7-dioxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydroindeno[5,4-f]quinolin-2-yl]acetate |
| SMILES | CCOC(=O)CC1C[C@H]2[C@@H]3CCC4N(C)C(=O)C=C[C@]4(C)[C@@H]3CC[C@]2(C)C1=O |
| InChI | InChI=1S/C23H33NO4/c1-5-28-20(26)13-14-12-17-15-6-7-18-22(2,11-9-19(25)24(18)4)16(15)8-10-23(17,3)21(14)27/h9,11,14-18H,5-8,10,12-13H2,1-4H3/t14?,15-,16-,17+,18?,22-,23+/m1/s1 |
| InChIKey | ITRWGEGLMKJLGU-PMLUEWFUSA-N |
| XLogP | 3.37 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |