C26H32FNO — CID 69302281
(3aS,3bS,5aR,9aR,9bS,11aS)-5-[(3-fluorophenyl)methylidene]-6,9a,11a-trimethyl-1,2,3,3a,3b,4,5a,9b,10,11-decahydroindeno[5,4-f]quinolin-7-one (PubChem CID 69302281) has the molecular formula C26H32FNO and a molecular weight of 393.55 g/mol. Its IUPAC name is (3aS,3bS,5aR,9aR,9bS,11aS)-5-[(3-fluorophenyl)methylidene]-6,9a,11a-trimethyl-1,2,3,3a,3b,4,5a,9b,10,11-decahydroindeno[5,4-f]quinolin-7-one.
| Compound Name | (3aS,3bS,5aR,9aR,9bS,11aS)-5-[(3-fluorophenyl)methylidene]-6,9a,11a-trimethyl-1,2,3,3a,3b,4,5a,9b,10,11-decahydroindeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 69302281 |
| Molecular Formula | C26H32FNO |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | (3aS,3bS,5aR,9aR,9bS,11aS)-5-[(3-fluorophenyl)methylidene]-6,9a,11a-trimethyl-1,2,3,3a,3b,4,5a,9b,10,11-decahydroindeno[5,4-f]quinolin-7-one |
| SMILES | CN1C(=O)C=C[C@]2(C)[C@H]3CC[C@]4(C)CCC[C@H]4[C@@H]3CC(=Cc3cccc(F)c3)[C@@H]12 |
| InChI | InChI=1S/C26H32FNO/c1-25-11-5-8-21(25)20-16-18(14-17-6-4-7-19(27)15-17)24-26(2,22(20)9-12-25)13-10-23(29)28(24)3/h4,6-7,10,13-15,20-22,24H,5,8-9,11-12,16H2,1-3H3/t20-,21-,22-,24+,25-,26+/m0/s1 |
| InChIKey | NWXZOVKNKSPTDD-SQRMQMBQSA-N |
| XLogP | 5.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |