About [4-(2,2-diethoxyethyl)phenyl]sulfanylphosphane
[4-(2,2-diethoxyethyl)phenyl]sulfanylphosphane (PubChem CID 69302502) has the molecular formula C12H19O2PS
and a molecular weight of 258.32 g/mol. Its IUPAC name is [4-(2,2-diethoxyethyl)phenyl]sulfanylphosphane.
Molecular Properties
| Compound Name | [4-(2,2-diethoxyethyl)phenyl]sulfanylphosphane |
| PubChem CID | 69302502 |
| Molecular Formula | C12H19O2PS |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | [4-(2,2-diethoxyethyl)phenyl]sulfanylphosphane |
| SMILES | CCOC(Cc1ccc(SP)cc1)OCC |
| InChI | InChI=1S/C12H19O2PS/c1-3-13-12(14-4-2)9-10-5-7-11(16-15)8-6-10/h5-8,12H,3-4,9,15H2,1-2H3 |
| InChIKey | XNCDOOMHNNUWBB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [4-(2,2-diethoxyethyl)phenyl]sulfanylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,2-diethoxyethyl)phenyl]sulfanylphosphane?
The IUPAC name of [4-(2,2-diethoxyethyl)phenyl]sulfanylphosphane (CID 69302502) is [4-(2,2-diethoxyethyl)phenyl]sulfanylphosphane.
What is the SMILES notation for [4-(2,2-diethoxyethyl)phenyl]sulfanylphosphane?
The canonical SMILES for [4-(2,2-diethoxyethyl)phenyl]sulfanylphosphane is CCOC(Cc1ccc(SP)cc1)OCC.
What is the InChIKey of [4-(2,2-diethoxyethyl)phenyl]sulfanylphosphane?
The InChIKey is XNCDOOMHNNUWBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19O2PS/c1-3-13-12(14-4-2)9-10-5-7-11(16-15)8-6-10/h5-8,12H,3-4,9,15H2,1-2H3.
What are the key properties of [4-(2,2-diethoxyethyl)phenyl]sulfanylphosphane?
[4-(2,2-diethoxyethyl)phenyl]sulfanylphosphane has a molecular weight of 258.32 g/mol, XLogP of 3.51, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,2-diethoxyethyl)phenyl]sulfanylphosphane is sourced from PubChem (CID 69302502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).