C21H18Cl2F2O5 — CID 69302606
methyl (E)-2-[2-[[3,5-dichloro-4-(3,3-difluoroprop-2-enoxy)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 69302606) has the molecular formula C21H18Cl2F2O5 and a molecular weight of 459.27 g/mol. Its IUPAC name is methyl (E)-2-[2-[[3,5-dichloro-4-(3,3-difluoroprop-2-enoxy)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[2-[[3,5-dichloro-4-(3,3-difluoroprop-2-enoxy)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 69302606 |
| Molecular Formula | C21H18Cl2F2O5 |
| Molecular Weight | 459.27 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | methyl (E)-2-[2-[[3,5-dichloro-4-(3,3-difluoroprop-2-enoxy)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1COc1cc(Cl)c(OCC=C(F)F)c(Cl)c1 |
| InChI | InChI=1S/C21H18Cl2F2O5/c1-27-12-16(21(26)28-2)15-6-4-3-5-13(15)11-30-14-9-17(22)20(18(23)10-14)29-8-7-19(24)25/h3-7,9-10,12H,8,11H2,1-2H3/b16-12+ |
| InChIKey | ZWVMRNIQNWIDEB-FOWTUZBSSA-N |
| XLogP | 5.89 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.27 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|