C20H22BFN2O2 — CID 69302717
2-benzyl-3-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 69302717) has the molecular formula C20H22BFN2O2 and a molecular weight of 352.22 g/mol. Its IUPAC name is 2-benzyl-3-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 2-benzyl-3-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 69302717 |
| Molecular Formula | C20H22BFN2O2 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 2-benzyl-3-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | CC1(C)OB(c2ccc3c(F)n(Cc4ccccc4)nc3c2)OC1(C)C |
| InChI | InChI=1S/C20H22BFN2O2/c1-19(2)20(3,4)26-21(25-19)15-10-11-16-17(12-15)23-24(18(16)22)13-14-8-6-5-7-9-14/h5-12H,13H2,1-4H3 |
| InChIKey | QYLZBUMSMAVESR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|