About benzyl-(3-ethoxy-2,2-dimethylpropoxy)-dimethylsilane
benzyl-(3-ethoxy-2,2-dimethylpropoxy)-dimethylsilane (PubChem CID 69302822) has the molecular formula C16H28O2Si
and a molecular weight of 280.48 g/mol. Its IUPAC name is benzyl-(3-ethoxy-2,2-dimethylpropoxy)-dimethylsilane.
Molecular Properties
| Compound Name | benzyl-(3-ethoxy-2,2-dimethylpropoxy)-dimethylsilane |
| PubChem CID | 69302822 |
| Molecular Formula | C16H28O2Si |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | benzyl-(3-ethoxy-2,2-dimethylpropoxy)-dimethylsilane |
| SMILES | CCOCC(C)(C)CO[Si](C)(C)Cc1ccccc1 |
| InChI | InChI=1S/C16H28O2Si/c1-6-17-13-16(2,3)14-18-19(4,5)12-15-10-8-7-9-11-15/h7-11H,6,12-14H2,1-5H3 |
| InChIKey | MDTVFJGLXCVJQG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzyl-(3-ethoxy-2,2-dimethylpropoxy)-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-(3-ethoxy-2,2-dimethylpropoxy)-dimethylsilane?
The IUPAC name of benzyl-(3-ethoxy-2,2-dimethylpropoxy)-dimethylsilane (CID 69302822) is benzyl-(3-ethoxy-2,2-dimethylpropoxy)-dimethylsilane.
What is the SMILES notation for benzyl-(3-ethoxy-2,2-dimethylpropoxy)-dimethylsilane?
The canonical SMILES for benzyl-(3-ethoxy-2,2-dimethylpropoxy)-dimethylsilane is CCOCC(C)(C)CO[Si](C)(C)Cc1ccccc1.
What is the InChIKey of benzyl-(3-ethoxy-2,2-dimethylpropoxy)-dimethylsilane?
The InChIKey is MDTVFJGLXCVJQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O2Si/c1-6-17-13-16(2,3)14-18-19(4,5)12-15-10-8-7-9-11-15/h7-11H,6,12-14H2,1-5H3.
What are the key properties of benzyl-(3-ethoxy-2,2-dimethylpropoxy)-dimethylsilane?
benzyl-(3-ethoxy-2,2-dimethylpropoxy)-dimethylsilane has a molecular weight of 280.48 g/mol, XLogP of 4.05, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-(3-ethoxy-2,2-dimethylpropoxy)-dimethylsilane is sourced from PubChem (CID 69302822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).