C16H19N5O2 — CID 69303458
5-(4-methylpiperazine-1-carbonyl)-4,6,12-triazatricyclo[6.4.1.04,13]trideca-1(13),5,7,9-tetraen-11-one (PubChem CID 69303458) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 5-(4-methylpiperazine-1-carbonyl)-4,6,12-triazatricyclo[6.4.1.04,13]trideca-1(13),5,7,9-tetraen-11-one.
| Compound Name | 5-(4-methylpiperazine-1-carbonyl)-4,6,12-triazatricyclo[6.4.1.04,13]trideca-1(13),5,7,9-tetraen-11-one |
|---|---|
| PubChem CID | 69303458 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 5-(4-methylpiperazine-1-carbonyl)-4,6,12-triazatricyclo[6.4.1.04,13]trideca-1(13),5,7,9-tetraen-11-one |
| SMILES | CN1CCN(C(=O)C2=NC=C3C=CC(=O)NC4=C3N2CC4)CC1 |
| InChI | InChI=1S/C16H19N5O2/c1-19-6-8-20(9-7-19)16(23)15-17-10-11-2-3-13(22)18-12-4-5-21(15)14(11)12/h2-3,10H,4-9H2,1H3,(H,18,22) |
| InChIKey | WOKXYRKIWSJARF-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |