C22H22N2O2 — CID 69303892
(3S)-1-hydroxy-4-(naphthalen-2-ylmethyl)-3-propan-2-yl-3H-quinoxalin-2-one (PubChem CID 69303892) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is (3S)-1-hydroxy-4-(naphthalen-2-ylmethyl)-3-propan-2-yl-3H-quinoxalin-2-one.
| Compound Name | (3S)-1-hydroxy-4-(naphthalen-2-ylmethyl)-3-propan-2-yl-3H-quinoxalin-2-one |
|---|---|
| PubChem CID | 69303892 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | (3S)-1-hydroxy-4-(naphthalen-2-ylmethyl)-3-propan-2-yl-3H-quinoxalin-2-one |
| SMILES | CC(C)[C@H]1C(=O)N(O)c2ccccc2N1Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H22N2O2/c1-15(2)21-22(25)24(26)20-10-6-5-9-19(20)23(21)14-16-11-12-17-7-3-4-8-18(17)13-16/h3-13,15,21,26H,14H2,1-2H3/t21-/m0/s1 |
| InChIKey | IVTKQFVBRZRSMI-NRFANRHFSA-N |
| XLogP | 4.61 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|