About (2S)-2-amino-3-(5,7-dibromo-1H-indol-3-yl)propanoic acid
(2S)-2-amino-3-(5,7-dibromo-1H-indol-3-yl)propanoic acid (PubChem CID 69304000) has the molecular formula C11H10Br2N2O2
and a molecular weight of 362.02 g/mol. Its IUPAC name is (2S)-2-amino-3-(5,7-dibromo-1H-indol-3-yl)propanoic acid.
Molecular Properties
| Compound Name | (2S)-2-amino-3-(5,7-dibromo-1H-indol-3-yl)propanoic acid |
| PubChem CID | 69304000 |
| Molecular Formula | C11H10Br2N2O2 |
| Molecular Weight | 362.02 g/mol |
| Exact Mass | 359.91 |
| IUPAC Name | (2S)-2-amino-3-(5,7-dibromo-1H-indol-3-yl)propanoic acid |
| SMILES | N[C@@H](Cc1c[nH]c2c(Br)cc(Br)cc12)C(=O)O |
| InChI | InChI=1S/C11H10Br2N2O2/c12-6-2-7-5(1-9(14)11(16)17)4-15-10(7)8(13)3-6/h2-4,9,15H,1,14H2,(H,16,17)/t9-/m0/s1 |
| InChIKey | UURVQGNSCUCIQS-VIFPVBQESA-N |
| XLogP | 2.65 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.02 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-amino-3-(5,7-dibromo-1H-indol-3-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3-(5,7-dibromo-1H-indol-3-yl)propanoic acid?
The IUPAC name of (2S)-2-amino-3-(5,7-dibromo-1H-indol-3-yl)propanoic acid (CID 69304000) is (2S)-2-amino-3-(5,7-dibromo-1H-indol-3-yl)propanoic acid.
What is the SMILES notation for (2S)-2-amino-3-(5,7-dibromo-1H-indol-3-yl)propanoic acid?
The canonical SMILES for (2S)-2-amino-3-(5,7-dibromo-1H-indol-3-yl)propanoic acid is N[C@@H](Cc1c[nH]c2c(Br)cc(Br)cc12)C(=O)O.
What is the InChIKey of (2S)-2-amino-3-(5,7-dibromo-1H-indol-3-yl)propanoic acid?
The InChIKey is UURVQGNSCUCIQS-VIFPVBQESA-N. The full InChI is InChI=1S/C11H10Br2N2O2/c12-6-2-7-5(1-9(14)11(16)17)4-15-10(7)8(13)3-6/h2-4,9,15H,1,14H2,(H,16,17)/t9-/m0/s1.
What are the key properties of (2S)-2-amino-3-(5,7-dibromo-1H-indol-3-yl)propanoic acid?
(2S)-2-amino-3-(5,7-dibromo-1H-indol-3-yl)propanoic acid has a molecular weight of 362.02 g/mol, XLogP of 2.65, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-(5,7-dibromo-1H-indol-3-yl)propanoic acid is sourced from PubChem (CID 69304000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).