C14H16N4O2 — CID 69304027
4-amino-9-(4-hydroxybutyl)-1,3-dihydroimidazo[4,5-c]quinolin-2-one (PubChem CID 69304027) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is 4-amino-9-(4-hydroxybutyl)-1,3-dihydroimidazo[4,5-c]quinolin-2-one.
| Compound Name | 4-amino-9-(4-hydroxybutyl)-1,3-dihydroimidazo[4,5-c]quinolin-2-one |
|---|---|
| PubChem CID | 69304027 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 4-amino-9-(4-hydroxybutyl)-1,3-dihydroimidazo[4,5-c]quinolin-2-one |
| SMILES | Nc1nc2cccc(CCCCO)c2c2[nH]c(=O)[nH]c12 |
| InChI | InChI=1S/C14H16N4O2/c15-13-12-11(17-14(20)18-12)10-8(4-1-2-7-19)5-3-6-9(10)16-13/h3,5-6,19H,1-2,4,7H2,(H2,15,16)(H2,17,18,20) |
| InChIKey | IYFXYGGABVXMRT-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|