C18H20N2O4 — CID 69304138
16,17-dihydroxy-6,13-dimethyl-8,11-diazatricyclo[10.3.1.13,7]heptadeca-1(16),3(17),4,6,12,14-hexaene-2-carboxylic acid (PubChem CID 69304138) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 16,17-dihydroxy-6,13-dimethyl-8,11-diazatricyclo[10.3.1.13,7]heptadeca-1(16),3(17),4,6,12,14-hexaene-2-carboxylic acid.
| Compound Name | 16,17-dihydroxy-6,13-dimethyl-8,11-diazatricyclo[10.3.1.13,7]heptadeca-1(16),3(17),4,6,12,14-hexaene-2-carboxylic acid |
|---|---|
| PubChem CID | 69304138 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 16,17-dihydroxy-6,13-dimethyl-8,11-diazatricyclo[10.3.1.13,7]heptadeca-1(16),3(17),4,6,12,14-hexaene-2-carboxylic acid |
| SMILES | Cc1ccc2c(O)c1NCCNc1c(C)ccc(c1O)C2C(=O)O |
| InChI | InChI=1S/C18H20N2O4/c1-9-3-5-11-13(18(23)24)12-6-4-10(2)15(17(12)22)20-8-7-19-14(9)16(11)21/h3-6,13,19-22H,7-8H2,1-2H3,(H,23,24) |
| InChIKey | WJIPCUKWUKFNOM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|