C37H42O17 — CID 69304495
(2R,3R,4R,5R)-2,5-bis[(2R,3R,4S,5R,6S)-6-(dihydroxymethyl)-3,4,5-trihydroxy-3-naphthalen-1-yloxan-2-yl]oxane-2,3,4,5-tetrol (PubChem CID 69304495) has the molecular formula C37H42O17 and a molecular weight of 758.73 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2,5-bis[(2R,3R,4S,5R,6S)-6-(dihydroxymethyl)-3,4,5-trihydroxy-3-naphthalen-1-yloxan-2-yl]oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4R,5R)-2,5-bis[(2R,3R,4S,5R,6S)-6-(dihydroxymethyl)-3,4,5-trihydroxy-3-naphthalen-1-yloxan-2-yl]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 69304495 |
| Molecular Formula | C37H42O17 |
| Molecular Weight | 758.73 g/mol |
| Exact Mass | 758.24 |
| IUPAC Name | (2R,3R,4R,5R)-2,5-bis[(2R,3R,4S,5R,6S)-6-(dihydroxymethyl)-3,4,5-trihydroxy-3-naphthalen-1-yloxan-2-yl]oxane-2,3,4,5-tetrol |
| SMILES | OC(O)[C@H]1O[C@@H]([C@@]2(O)CO[C@@](O)([C@@H]3O[C@H](C(O)O)[C@H](O)[C@H](O)[C@]3(O)c3cccc4ccccc34)[C@H](O)[C@H]2O)[C@@](O)(c2cccc3ccccc23)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C37H42O17/c38-22-24(30(44)45)53-32(35(49,26(22)40)20-13-5-9-16-7-1-3-11-18(16)20)34(48)15-52-37(51,29(43)28(34)42)33-36(50,27(41)23(39)25(54-33)31(46)47)21-14-6-10-17-8-2-4-12-19(17)21/h1-14,22-33,38-51H,15H2/t22-,23-,24-,25-,26-,27-,28+,29+,32-,33+,34+,35+,36+,37+/m0/s1 |
| InChIKey | OLHZZCQVSPJPFO-ZOUYZLGWSA-N |
| XLogP | -4.16 |
| TPSA | 310.91 Ų |
| H-Bond Donors | 14 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.73 |
| LogP ≤ 5 | -4.16 |
| H-Bond Donors ≤ 5 | 14 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|