C8H12N2O — CID 69304823
3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2-carboxamide (PubChem CID 69304823) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is 3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2-carboxamide.
| Compound Name | 3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 69304823 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2-carboxamide |
| SMILES | NC(=O)N1CC2C=CCC2C1 |
| InChI | InChI=1S/C8H12N2O/c9-8(11)10-4-6-2-1-3-7(6)5-10/h1-2,6-7H,3-5H2,(H2,9,11) |
| InChIKey | IHPVFLOPUCNCTR-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|