C24H30OSi — CID 69305098
dimethyl-(1-prop-2-enoxynaphthalen-2-yl)-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 69305098) has the molecular formula C24H30OSi and a molecular weight of 362.59 g/mol. Its IUPAC name is dimethyl-(1-prop-2-enoxynaphthalen-2-yl)-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | dimethyl-(1-prop-2-enoxynaphthalen-2-yl)-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 69305098 |
| Molecular Formula | C24H30OSi |
| Molecular Weight | 362.59 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | dimethyl-(1-prop-2-enoxynaphthalen-2-yl)-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | C=CCOc1c([Si](C)(C)C2C(C)=C(C)C(C)=C2C)ccc2ccccc12 |
| InChI | InChI=1S/C24H30OSi/c1-8-15-25-23-21-12-10-9-11-20(21)13-14-22(23)26(6,7)24-18(4)16(2)17(3)19(24)5/h8-14,24H,1,15H2,2-7H3 |
| InChIKey | PYHXNEUVXPVJQJ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.59 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|