About methyl 2-[(3S,4S)-3,4-dimethyl-1-(nitromethyl)cyclopentyl]acetate
methyl 2-[(3S,4S)-3,4-dimethyl-1-(nitromethyl)cyclopentyl]acetate (PubChem CID 69305217) has the molecular formula C11H19NO4
and a molecular weight of 229.28 g/mol. Its IUPAC name is methyl 2-[(3S,4S)-3,4-dimethyl-1-(nitromethyl)cyclopentyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(3S,4S)-3,4-dimethyl-1-(nitromethyl)cyclopentyl]acetate |
| PubChem CID | 69305217 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | methyl 2-[(3S,4S)-3,4-dimethyl-1-(nitromethyl)cyclopentyl]acetate |
| SMILES | COC(=O)CC1(C[N+](=O)[O-])C[C@H](C)[C@@H](C)C1 |
| InChI | InChI=1S/C11H19NO4/c1-8-4-11(5-9(8)2,7-12(14)15)6-10(13)16-3/h8-9H,4-7H2,1-3H3/t8-,9-/m0/s1 |
| InChIKey | ZALVWYZBENPWAM-IUCAKERBSA-N |
| XLogP | 1.88 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(3S,4S)-3,4-dimethyl-1-(nitromethyl)cyclopentyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(3S,4S)-3,4-dimethyl-1-(nitromethyl)cyclopentyl]acetate?
The IUPAC name of methyl 2-[(3S,4S)-3,4-dimethyl-1-(nitromethyl)cyclopentyl]acetate (CID 69305217) is methyl 2-[(3S,4S)-3,4-dimethyl-1-(nitromethyl)cyclopentyl]acetate.
What is the SMILES notation for methyl 2-[(3S,4S)-3,4-dimethyl-1-(nitromethyl)cyclopentyl]acetate?
The canonical SMILES for methyl 2-[(3S,4S)-3,4-dimethyl-1-(nitromethyl)cyclopentyl]acetate is COC(=O)CC1(C[N+](=O)[O-])C[C@H](C)[C@@H](C)C1.
What is the InChIKey of methyl 2-[(3S,4S)-3,4-dimethyl-1-(nitromethyl)cyclopentyl]acetate?
The InChIKey is ZALVWYZBENPWAM-IUCAKERBSA-N. The full InChI is InChI=1S/C11H19NO4/c1-8-4-11(5-9(8)2,7-12(14)15)6-10(13)16-3/h8-9H,4-7H2,1-3H3/t8-,9-/m0/s1.
What are the key properties of methyl 2-[(3S,4S)-3,4-dimethyl-1-(nitromethyl)cyclopentyl]acetate?
methyl 2-[(3S,4S)-3,4-dimethyl-1-(nitromethyl)cyclopentyl]acetate has a molecular weight of 229.28 g/mol, XLogP of 1.88, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3S,4S)-3,4-dimethyl-1-(nitromethyl)cyclopentyl]acetate is sourced from PubChem (CID 69305217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).