About 4-(5-aminocyclohexa-2,4-dien-1-ylidene)-2-methylbutan-2-ol
4-(5-aminocyclohexa-2,4-dien-1-ylidene)-2-methylbutan-2-ol (PubChem CID 69305731) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 4-(5-aminocyclohexa-2,4-dien-1-ylidene)-2-methylbutan-2-ol.
Molecular Properties
| Compound Name | 4-(5-aminocyclohexa-2,4-dien-1-ylidene)-2-methylbutan-2-ol |
| PubChem CID | 69305731 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 4-(5-aminocyclohexa-2,4-dien-1-ylidene)-2-methylbutan-2-ol |
| SMILES | CC(C)(O)CC=C1C=CC=C(N)C1 |
| InChI | InChI=1S/C11H17NO/c1-11(2,13)7-6-9-4-3-5-10(12)8-9/h3-6,13H,7-8,12H2,1-2H3 |
| InChIKey | NJBVKKPRRXYUBW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(5-aminocyclohexa-2,4-dien-1-ylidene)-2-methylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-aminocyclohexa-2,4-dien-1-ylidene)-2-methylbutan-2-ol?
The IUPAC name of 4-(5-aminocyclohexa-2,4-dien-1-ylidene)-2-methylbutan-2-ol (CID 69305731) is 4-(5-aminocyclohexa-2,4-dien-1-ylidene)-2-methylbutan-2-ol.
What is the SMILES notation for 4-(5-aminocyclohexa-2,4-dien-1-ylidene)-2-methylbutan-2-ol?
The canonical SMILES for 4-(5-aminocyclohexa-2,4-dien-1-ylidene)-2-methylbutan-2-ol is CC(C)(O)CC=C1C=CC=C(N)C1.
What is the InChIKey of 4-(5-aminocyclohexa-2,4-dien-1-ylidene)-2-methylbutan-2-ol?
The InChIKey is NJBVKKPRRXYUBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-11(2,13)7-6-9-4-3-5-10(12)8-9/h3-6,13H,7-8,12H2,1-2H3.
What are the key properties of 4-(5-aminocyclohexa-2,4-dien-1-ylidene)-2-methylbutan-2-ol?
4-(5-aminocyclohexa-2,4-dien-1-ylidene)-2-methylbutan-2-ol has a molecular weight of 179.26 g/mol, XLogP of 1.88, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-aminocyclohexa-2,4-dien-1-ylidene)-2-methylbutan-2-ol is sourced from PubChem (CID 69305731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).