About 1-hydroxy-3,5-dimethylpyrazolidine
1-hydroxy-3,5-dimethylpyrazolidine (PubChem CID 69305760) has the molecular formula C5H12N2O
and a molecular weight of 116.16 g/mol. Its IUPAC name is 1-hydroxy-3,5-dimethylpyrazolidine.
Molecular Properties
| Compound Name | 1-hydroxy-3,5-dimethylpyrazolidine |
| PubChem CID | 69305760 |
| Molecular Formula | C5H12N2O |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.09 |
| IUPAC Name | 1-hydroxy-3,5-dimethylpyrazolidine |
| SMILES | CC1CC(C)N(O)N1 |
| InChI | InChI=1S/C5H12N2O/c1-4-3-5(2)7(8)6-4/h4-6,8H,3H2,1-2H3 |
| InChIKey | GCRXWMWBMRWRJT-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-hydroxy-3,5-dimethylpyrazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-3,5-dimethylpyrazolidine?
The IUPAC name of 1-hydroxy-3,5-dimethylpyrazolidine (CID 69305760) is 1-hydroxy-3,5-dimethylpyrazolidine.
What is the SMILES notation for 1-hydroxy-3,5-dimethylpyrazolidine?
The canonical SMILES for 1-hydroxy-3,5-dimethylpyrazolidine is CC1CC(C)N(O)N1.
What is the InChIKey of 1-hydroxy-3,5-dimethylpyrazolidine?
The InChIKey is GCRXWMWBMRWRJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O/c1-4-3-5(2)7(8)6-4/h4-6,8H,3H2,1-2H3.
What are the key properties of 1-hydroxy-3,5-dimethylpyrazolidine?
1-hydroxy-3,5-dimethylpyrazolidine has a molecular weight of 116.16 g/mol, XLogP of 0.36, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-3,5-dimethylpyrazolidine is sourced from PubChem (CID 69305760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).