About 2-[1-(2,5-dimethylcyclopenta-1,4-dien-1-yl)ethoxy]oxane
2-[1-(2,5-dimethylcyclopenta-1,4-dien-1-yl)ethoxy]oxane (PubChem CID 69305784) has the molecular formula C14H22O2
and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-[1-(2,5-dimethylcyclopenta-1,4-dien-1-yl)ethoxy]oxane.
Molecular Properties
| Compound Name | 2-[1-(2,5-dimethylcyclopenta-1,4-dien-1-yl)ethoxy]oxane |
| PubChem CID | 69305784 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 2-[1-(2,5-dimethylcyclopenta-1,4-dien-1-yl)ethoxy]oxane |
| SMILES | CC1=CCC(C)=C1C(C)OC1CCCCO1 |
| InChI | InChI=1S/C14H22O2/c1-10-7-8-11(2)14(10)12(3)16-13-6-4-5-9-15-13/h7,12-13H,4-6,8-9H2,1-3H3 |
| InChIKey | OWBGSUUCAOPQBF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[1-(2,5-dimethylcyclopenta-1,4-dien-1-yl)ethoxy]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(2,5-dimethylcyclopenta-1,4-dien-1-yl)ethoxy]oxane?
The IUPAC name of 2-[1-(2,5-dimethylcyclopenta-1,4-dien-1-yl)ethoxy]oxane (CID 69305784) is 2-[1-(2,5-dimethylcyclopenta-1,4-dien-1-yl)ethoxy]oxane.
What is the SMILES notation for 2-[1-(2,5-dimethylcyclopenta-1,4-dien-1-yl)ethoxy]oxane?
The canonical SMILES for 2-[1-(2,5-dimethylcyclopenta-1,4-dien-1-yl)ethoxy]oxane is CC1=CCC(C)=C1C(C)OC1CCCCO1.
What is the InChIKey of 2-[1-(2,5-dimethylcyclopenta-1,4-dien-1-yl)ethoxy]oxane?
The InChIKey is OWBGSUUCAOPQBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O2/c1-10-7-8-11(2)14(10)12(3)16-13-6-4-5-9-15-13/h7,12-13H,4-6,8-9H2,1-3H3.
What are the key properties of 2-[1-(2,5-dimethylcyclopenta-1,4-dien-1-yl)ethoxy]oxane?
2-[1-(2,5-dimethylcyclopenta-1,4-dien-1-yl)ethoxy]oxane has a molecular weight of 222.33 g/mol, XLogP of 3.58, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2,5-dimethylcyclopenta-1,4-dien-1-yl)ethoxy]oxane is sourced from PubChem (CID 69305784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).