About decyl(triphenyl)azanium iodide
decyl(triphenyl)azanium iodide (PubChem CID 69306188) has the molecular formula C28H36IN
and a molecular weight of 513.51 g/mol. Its IUPAC name is decyl(triphenyl)azanium iodide.
Molecular Properties
| Compound Name | decyl(triphenyl)azanium iodide |
| PubChem CID | 69306188 |
| Molecular Formula | C28H36IN |
| Molecular Weight | 513.51 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | decyl(triphenyl)azanium iodide |
| SMILES | CCCCCCCCCC[N+](c1ccccc1)(c1ccccc1)c1ccccc1.[I-] |
| InChI | InChI=1S/C28H36N.HI/c1-2-3-4-5-6-7-8-18-25-29(26-19-12-9-13-20-26,27-21-14-10-15-22-27)28-23-16-11-17-24-28;/h9-17,19-24H,2-8,18,25H2,1H3;1H/q+1;/p-1 |
| InChIKey | CFGJJZDHQXQFOW-UHFFFAOYSA-M |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 513.51 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze decyl(triphenyl)azanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decyl(triphenyl)azanium iodide?
The IUPAC name of decyl(triphenyl)azanium iodide (CID 69306188) is decyl(triphenyl)azanium iodide.
What is the SMILES notation for decyl(triphenyl)azanium iodide?
The canonical SMILES for decyl(triphenyl)azanium iodide is CCCCCCCCCC[N+](c1ccccc1)(c1ccccc1)c1ccccc1.[I-].
What is the InChIKey of decyl(triphenyl)azanium iodide?
The InChIKey is CFGJJZDHQXQFOW-UHFFFAOYSA-M. The full InChI is InChI=1S/C28H36N.HI/c1-2-3-4-5-6-7-8-18-25-29(26-19-12-9-13-20-26,27-21-14-10-15-22-27)28-23-16-11-17-24-28;/h9-17,19-24H,2-8,18,25H2,1H3;1H/q+1;/p-1.
What are the key properties of decyl(triphenyl)azanium iodide?
decyl(triphenyl)azanium iodide has a molecular weight of 513.51 g/mol, XLogP of 5.80, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for decyl(triphenyl)azanium iodide is sourced from PubChem (CID 69306188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).