About 2-(5-chloro-1,3-dihydro-2-benzofuran-1-yl)ethanol
2-(5-chloro-1,3-dihydro-2-benzofuran-1-yl)ethanol (PubChem CID 69306515) has the molecular formula C10H11ClO2
and a molecular weight of 198.65 g/mol. Its IUPAC name is 2-(5-chloro-1,3-dihydro-2-benzofuran-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-(5-chloro-1,3-dihydro-2-benzofuran-1-yl)ethanol |
| PubChem CID | 69306515 |
| Molecular Formula | C10H11ClO2 |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 2-(5-chloro-1,3-dihydro-2-benzofuran-1-yl)ethanol |
| SMILES | OCCC1OCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C10H11ClO2/c11-8-1-2-9-7(5-8)6-13-10(9)3-4-12/h1-2,5,10,12H,3-4,6H2 |
| InChIKey | XHVRWIWDBIVBIY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(5-chloro-1,3-dihydro-2-benzofuran-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloro-1,3-dihydro-2-benzofuran-1-yl)ethanol?
The IUPAC name of 2-(5-chloro-1,3-dihydro-2-benzofuran-1-yl)ethanol (CID 69306515) is 2-(5-chloro-1,3-dihydro-2-benzofuran-1-yl)ethanol.
What is the SMILES notation for 2-(5-chloro-1,3-dihydro-2-benzofuran-1-yl)ethanol?
The canonical SMILES for 2-(5-chloro-1,3-dihydro-2-benzofuran-1-yl)ethanol is OCCC1OCc2cc(Cl)ccc21.
What is the InChIKey of 2-(5-chloro-1,3-dihydro-2-benzofuran-1-yl)ethanol?
The InChIKey is XHVRWIWDBIVBIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO2/c11-8-1-2-9-7(5-8)6-13-10(9)3-4-12/h1-2,5,10,12H,3-4,6H2.
What are the key properties of 2-(5-chloro-1,3-dihydro-2-benzofuran-1-yl)ethanol?
2-(5-chloro-1,3-dihydro-2-benzofuran-1-yl)ethanol has a molecular weight of 198.65 g/mol, XLogP of 2.29, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-1,3-dihydro-2-benzofuran-1-yl)ethanol is sourced from PubChem (CID 69306515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).