C23H16ClF3N4O3 — CID 69306594
2-chloro-4-[(1S,6S,7S)-3,5-dioxo-8-[2-(trifluoromethyl)benzoyl]-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-3-methylbenzonitrile (PubChem CID 69306594) has the molecular formula C23H16ClF3N4O3 and a molecular weight of 488.85 g/mol. Its IUPAC name is 2-chloro-4-[(1S,6S,7S)-3,5-dioxo-8-[2-(trifluoromethyl)benzoyl]-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-3-methylbenzonitrile.
| Compound Name | 2-chloro-4-[(1S,6S,7S)-3,5-dioxo-8-[2-(trifluoromethyl)benzoyl]-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 69306594 |
| Molecular Formula | C23H16ClF3N4O3 |
| Molecular Weight | 488.85 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | 2-chloro-4-[(1S,6S,7S)-3,5-dioxo-8-[2-(trifluoromethyl)benzoyl]-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-3-methylbenzonitrile |
| SMILES | Cc1c(N2C(=O)[C@@H]3[C@@H]4C[C@@H](CN4C(=O)c4ccccc4C(F)(F)F)N3C2=O)ccc(C#N)c1Cl |
| InChI | InChI=1S/C23H16ClF3N4O3/c1-11-16(7-6-12(9-28)18(11)24)31-21(33)19-17-8-13(30(19)22(31)34)10-29(17)20(32)14-4-2-3-5-15(14)23(25,26)27/h2-7,13,17,19H,8,10H2,1H3/t13-,17-,19-/m0/s1 |
| InChIKey | FAPWMQGYHJEVBF-IXDGSTSKSA-N |
| XLogP | 3.97 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.85 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|