C18H22N4O4S — CID 69306674
2-[2-[(4-amino-2-propyl-[1,3]thiazolo[4,5-c]quinolin-7-yl)oxy]ethoxy]ethylcarbamic acid (PubChem CID 69306674) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is 2-[2-[(4-amino-2-propyl-[1,3]thiazolo[4,5-c]quinolin-7-yl)oxy]ethoxy]ethylcarbamic acid.
| Compound Name | 2-[2-[(4-amino-2-propyl-[1,3]thiazolo[4,5-c]quinolin-7-yl)oxy]ethoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 69306674 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 2-[2-[(4-amino-2-propyl-[1,3]thiazolo[4,5-c]quinolin-7-yl)oxy]ethoxy]ethylcarbamic acid |
| SMILES | CCCc1nc2c(N)nc3cc(OCCOCCNC(=O)O)ccc3c2s1 |
| InChI | InChI=1S/C18H22N4O4S/c1-2-3-14-22-15-16(27-14)12-5-4-11(10-13(12)21-17(15)19)26-9-8-25-7-6-20-18(23)24/h4-5,10,20H,2-3,6-9H2,1H3,(H2,19,21)(H,23,24) |
| InChIKey | FSKRHECJRXBTOL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|