About 5H-isoindole-1,3,4-trione;hydrochloride
5H-isoindole-1,3,4-trione;hydrochloride (PubChem CID 69306928) has the molecular formula C8H6ClNO3
and a molecular weight of 199.59 g/mol. Its IUPAC name is 5H-isoindole-1,3,4-trione;hydrochloride.
Molecular Properties
| Compound Name | 5H-isoindole-1,3,4-trione;hydrochloride |
| PubChem CID | 69306928 |
| Molecular Formula | C8H6ClNO3 |
| Molecular Weight | 199.59 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | 5H-isoindole-1,3,4-trione;hydrochloride |
| SMILES | Cl.O=C1CC=CC2=C1C(=O)NC2=O |
| InChI | InChI=1S/C8H5NO3.ClH/c10-5-3-1-2-4-6(5)8(12)9-7(4)11;/h1-2H,3H2,(H,9,11,12);1H |
| InChIKey | TUMKXPPLHRINFO-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.59 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5H-isoindole-1,3,4-trione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-isoindole-1,3,4-trione;hydrochloride?
The IUPAC name of 5H-isoindole-1,3,4-trione;hydrochloride (CID 69306928) is 5H-isoindole-1,3,4-trione;hydrochloride.
What is the SMILES notation for 5H-isoindole-1,3,4-trione;hydrochloride?
The canonical SMILES for 5H-isoindole-1,3,4-trione;hydrochloride is Cl.O=C1CC=CC2=C1C(=O)NC2=O.
What is the InChIKey of 5H-isoindole-1,3,4-trione;hydrochloride?
The InChIKey is TUMKXPPLHRINFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO3.ClH/c10-5-3-1-2-4-6(5)8(12)9-7(4)11;/h1-2H,3H2,(H,9,11,12);1H.
What are the key properties of 5H-isoindole-1,3,4-trione;hydrochloride?
5H-isoindole-1,3,4-trione;hydrochloride has a molecular weight of 199.59 g/mol, XLogP of -0.11, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-isoindole-1,3,4-trione;hydrochloride is sourced from PubChem (CID 69306928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).