C26H33BrN4O2 — CID 69306996
ethyl 5-[4-(5-bromo-3-pyridinyl)-7-ethyl-2-(pyrrolidin-1-ylmethyl)pyrrolo[1,2-b]pyridazin-3-yl]pentanoate (PubChem CID 69306996) has the molecular formula C26H33BrN4O2 and a molecular weight of 513.48 g/mol. Its IUPAC name is ethyl 5-[4-(5-bromo-3-pyridinyl)-7-ethyl-2-(pyrrolidin-1-ylmethyl)pyrrolo[1,2-b]pyridazin-3-yl]pentanoate.
| Compound Name | ethyl 5-[4-(5-bromo-3-pyridinyl)-7-ethyl-2-(pyrrolidin-1-ylmethyl)pyrrolo[1,2-b]pyridazin-3-yl]pentanoate |
|---|---|
| PubChem CID | 69306996 |
| Molecular Formula | C26H33BrN4O2 |
| Molecular Weight | 513.48 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | ethyl 5-[4-(5-bromo-3-pyridinyl)-7-ethyl-2-(pyrrolidin-1-ylmethyl)pyrrolo[1,2-b]pyridazin-3-yl]pentanoate |
| SMILES | CCOC(=O)CCCCc1c(CN2CCCC2)nn2c(CC)ccc2c1-c1cncc(Br)c1 |
| InChI | InChI=1S/C26H33BrN4O2/c1-3-21-11-12-24-26(19-15-20(27)17-28-16-19)22(9-5-6-10-25(32)33-4-2)23(29-31(21)24)18-30-13-7-8-14-30/h11-12,15-17H,3-10,13-14,18H2,1-2H3 |
| InChIKey | RWPWYAYEDIQOSU-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.48 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|