About 1-(2-hydroxyethyl)-1,3-dihydro-2-benzofuran-5-carboxamide
1-(2-hydroxyethyl)-1,3-dihydro-2-benzofuran-5-carboxamide (PubChem CID 69307270) has the molecular formula C11H13NO3
and a molecular weight of 207.23 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-1,3-dihydro-2-benzofuran-5-carboxamide.
Molecular Properties
| Compound Name | 1-(2-hydroxyethyl)-1,3-dihydro-2-benzofuran-5-carboxamide |
| PubChem CID | 69307270 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 1-(2-hydroxyethyl)-1,3-dihydro-2-benzofuran-5-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)COC2CCO |
| InChI | InChI=1S/C11H13NO3/c12-11(14)7-1-2-9-8(5-7)6-15-10(9)3-4-13/h1-2,5,10,13H,3-4,6H2,(H2,12,14) |
| InChIKey | VVAZSSGRMQEHMI-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-hydroxyethyl)-1,3-dihydro-2-benzofuran-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxyethyl)-1,3-dihydro-2-benzofuran-5-carboxamide?
The IUPAC name of 1-(2-hydroxyethyl)-1,3-dihydro-2-benzofuran-5-carboxamide (CID 69307270) is 1-(2-hydroxyethyl)-1,3-dihydro-2-benzofuran-5-carboxamide.
What is the SMILES notation for 1-(2-hydroxyethyl)-1,3-dihydro-2-benzofuran-5-carboxamide?
The canonical SMILES for 1-(2-hydroxyethyl)-1,3-dihydro-2-benzofuran-5-carboxamide is NC(=O)c1ccc2c(c1)COC2CCO.
What is the InChIKey of 1-(2-hydroxyethyl)-1,3-dihydro-2-benzofuran-5-carboxamide?
The InChIKey is VVAZSSGRMQEHMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3/c12-11(14)7-1-2-9-8(5-7)6-15-10(9)3-4-13/h1-2,5,10,13H,3-4,6H2,(H2,12,14).
What are the key properties of 1-(2-hydroxyethyl)-1,3-dihydro-2-benzofuran-5-carboxamide?
1-(2-hydroxyethyl)-1,3-dihydro-2-benzofuran-5-carboxamide has a molecular weight of 207.23 g/mol, XLogP of 0.74, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxyethyl)-1,3-dihydro-2-benzofuran-5-carboxamide is sourced from PubChem (CID 69307270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).