C44H60N4O2 — CID 69307563
1-N,2-N-bis[4-[2-[(1R,8S)-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-yl]ethyl]cyclohexyl]cyclohexane-1,2-dicarboxamide (PubChem CID 69307563) has the molecular formula C44H60N4O2 and a molecular weight of 676.99 g/mol. Its IUPAC name is 1-N,2-N-bis[4-[2-[(1R,8S)-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-yl]ethyl]cyclohexyl]cyclohexane-1,2-dicarboxamide.
| Compound Name | 1-N,2-N-bis[4-[2-[(1R,8S)-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-yl]ethyl]cyclohexyl]cyclohexane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 69307563 |
| Molecular Formula | C44H60N4O2 |
| Molecular Weight | 676.99 g/mol |
| Exact Mass | 676.47 |
| IUPAC Name | 1-N,2-N-bis[4-[2-[(1R,8S)-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-yl]ethyl]cyclohexyl]cyclohexane-1,2-dicarboxamide |
| SMILES | O=C(NC1CCC(CCN2[C@@H]3CC[C@H]2c2ccccc23)CC1)C1CCCCC1C(=O)NC1CCC(CCN2[C@@H]3CC[C@H]2c2ccccc23)CC1 |
| InChI | InChI=1S/C44H60N4O2/c49-43(45-31-17-13-29(14-18-31)25-27-47-39-21-22-40(47)34-8-2-1-7-33(34)39)37-11-5-6-12-38(37)44(50)46-32-19-15-30(16-20-32)26-28-48-41-23-24-42(48)36-10-4-3-9-35(36)41/h1-4,7-10,29-32,37-42H,5-6,11-28H2,(H,45,49)(H,46,50)/t29?,30?,31?,32?,37?,38?,39-,40+,41-,42+ |
| InChIKey | RLLGUSLQVWKFHN-LRZUJCKCSA-N |
| XLogP | 8.71 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.99 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |