C26H18Cl2N2O4 — CID 69308289
3-[4-(1,3-benzodioxol-5-yl)-5-(2,5-dichlorophenyl)-1H-imidazol-2-yl]-2-(3-methylphenyl)prop-2-enoic acid (PubChem CID 69308289) has the molecular formula C26H18Cl2N2O4 and a molecular weight of 493.35 g/mol. Its IUPAC name is 3-[4-(1,3-benzodioxol-5-yl)-5-(2,5-dichlorophenyl)-1H-imidazol-2-yl]-2-(3-methylphenyl)prop-2-enoic acid.
| Compound Name | 3-[4-(1,3-benzodioxol-5-yl)-5-(2,5-dichlorophenyl)-1H-imidazol-2-yl]-2-(3-methylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 69308289 |
| Molecular Formula | C26H18Cl2N2O4 |
| Molecular Weight | 493.35 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | 3-[4-(1,3-benzodioxol-5-yl)-5-(2,5-dichlorophenyl)-1H-imidazol-2-yl]-2-(3-methylphenyl)prop-2-enoic acid |
| SMILES | Cc1cccc(C(=Cc2nc(-c3ccc4c(c3)OCO4)c(-c3cc(Cl)ccc3Cl)[nH]2)C(=O)O)c1 |
| InChI | InChI=1S/C26H18Cl2N2O4/c1-14-3-2-4-15(9-14)18(26(31)32)12-23-29-24(16-5-8-21-22(10-16)34-13-33-21)25(30-23)19-11-17(27)6-7-20(19)28/h2-12H,13H2,1H3,(H,29,30)(H,31,32) |
| InChIKey | LKIBBQNUBNFUAV-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.35 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|