About 4-N,4-N-dibenzyl-1-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclohexane-1,4-diamine
4-N,4-N-dibenzyl-1-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclohexane-1,4-diamine (PubChem CID 69308518) has the molecular formula C28H44N2OSi
and a molecular weight of 452.76 g/mol. Its IUPAC name is 4-N,4-N-dibenzyl-1-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclohexane-1,4-diamine.
Molecular Properties
| Compound Name | 4-N,4-N-dibenzyl-1-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclohexane-1,4-diamine |
| PubChem CID | 69308518 |
| Molecular Formula | C28H44N2OSi |
| Molecular Weight | 452.76 g/mol |
| Exact Mass | 452.32 |
| IUPAC Name | 4-N,4-N-dibenzyl-1-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclohexane-1,4-diamine |
| SMILES | CC(C)(C)[Si](C)(C)OCCNC1CCC(N(Cc2ccccc2)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H44N2OSi/c1-28(2,3)32(4,5)31-21-20-29-26-16-18-27(19-17-26)30(22-24-12-8-6-9-13-24)23-25-14-10-7-11-15-25/h6-15,26-27,29H,16-23H2,1-5H3 |
| InChIKey | JWWGKPTWLWBSTK-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.76 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-N,4-N-dibenzyl-1-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclohexane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N,4-N-dibenzyl-1-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclohexane-1,4-diamine?
The IUPAC name of 4-N,4-N-dibenzyl-1-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclohexane-1,4-diamine (CID 69308518) is 4-N,4-N-dibenzyl-1-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclohexane-1,4-diamine.
What is the SMILES notation for 4-N,4-N-dibenzyl-1-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclohexane-1,4-diamine?
The canonical SMILES for 4-N,4-N-dibenzyl-1-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclohexane-1,4-diamine is CC(C)(C)[Si](C)(C)OCCNC1CCC(N(Cc2ccccc2)Cc2ccccc2)CC1.
What is the InChIKey of 4-N,4-N-dibenzyl-1-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclohexane-1,4-diamine?
The InChIKey is JWWGKPTWLWBSTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H44N2OSi/c1-28(2,3)32(4,5)31-21-20-29-26-16-18-27(19-17-26)30(22-24-12-8-6-9-13-24)23-25-14-10-7-11-15-25/h6-15,26-27,29H,16-23H2,1-5H3.
What are the key properties of 4-N,4-N-dibenzyl-1-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclohexane-1,4-diamine?
4-N,4-N-dibenzyl-1-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclohexane-1,4-diamine has a molecular weight of 452.76 g/mol, XLogP of 6.61, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N,4-N-dibenzyl-1-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclohexane-1,4-diamine is sourced from PubChem (CID 69308518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).