About 11-ethylisoindolo[2,3-a]indol-6-one;N-methylmethanamine
11-ethylisoindolo[2,3-a]indol-6-one;N-methylmethanamine (PubChem CID 69309273) has the molecular formula C19H20N2O
and a molecular weight of 292.38 g/mol. Its IUPAC name is 11-ethylisoindolo[2,3-a]indol-6-one;N-methylmethanamine.
Molecular Properties
| Compound Name | 11-ethylisoindolo[2,3-a]indol-6-one;N-methylmethanamine |
| PubChem CID | 69309273 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 11-ethylisoindolo[2,3-a]indol-6-one;N-methylmethanamine |
| SMILES | CCc1c2n(c3ccccc13)C(=O)c1ccccc1-2.CNC |
| InChI | InChI=1S/C17H13NO.C2H7N/c1-2-11-12-7-5-6-10-15(12)18-16(11)13-8-3-4-9-14(13)17(18)19;1-3-2/h3-10H,2H2,1H3;3H,1-2H3 |
| InChIKey | UJVOYRNRSUEZLH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 11-ethylisoindolo[2,3-a]indol-6-one;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-ethylisoindolo[2,3-a]indol-6-one;N-methylmethanamine?
The IUPAC name of 11-ethylisoindolo[2,3-a]indol-6-one;N-methylmethanamine (CID 69309273) is 11-ethylisoindolo[2,3-a]indol-6-one;N-methylmethanamine.
What is the SMILES notation for 11-ethylisoindolo[2,3-a]indol-6-one;N-methylmethanamine?
The canonical SMILES for 11-ethylisoindolo[2,3-a]indol-6-one;N-methylmethanamine is CCc1c2n(c3ccccc13)C(=O)c1ccccc1-2.CNC.
What is the InChIKey of 11-ethylisoindolo[2,3-a]indol-6-one;N-methylmethanamine?
The InChIKey is UJVOYRNRSUEZLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO.C2H7N/c1-2-11-12-7-5-6-10-15(12)18-16(11)13-8-3-4-9-14(13)17(18)19;1-3-2/h3-10H,2H2,1H3;3H,1-2H3.
What are the key properties of 11-ethylisoindolo[2,3-a]indol-6-one;N-methylmethanamine?
11-ethylisoindolo[2,3-a]indol-6-one;N-methylmethanamine has a molecular weight of 292.38 g/mol, XLogP of 3.71, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11-ethylisoindolo[2,3-a]indol-6-one;N-methylmethanamine is sourced from PubChem (CID 69309273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).