C19H29ClN2O3 — CID 69309645
tert-butyl 4-[[2-amino-2-(2-chlorophenyl)ethoxy]methyl]piperidine-1-carboxylate (PubChem CID 69309645) has the molecular formula C19H29ClN2O3 and a molecular weight of 368.91 g/mol. Its IUPAC name is tert-butyl 4-[[2-amino-2-(2-chlorophenyl)ethoxy]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-amino-2-(2-chlorophenyl)ethoxy]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 69309645 |
| Molecular Formula | C19H29ClN2O3 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | tert-butyl 4-[[2-amino-2-(2-chlorophenyl)ethoxy]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(COCC(N)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C19H29ClN2O3/c1-19(2,3)25-18(23)22-10-8-14(9-11-22)12-24-13-17(21)15-6-4-5-7-16(15)20/h4-7,14,17H,8-13,21H2,1-3H3 |
| InChIKey | WZBOHAXLSYJXOS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |