About 3-chloro-4-[5-[(2,4-dimethylphenyl)methyl]-1H-pyrazol-3-yl]pyridine
3-chloro-4-[5-[(2,4-dimethylphenyl)methyl]-1H-pyrazol-3-yl]pyridine (PubChem CID 69309763) has the molecular formula C17H16ClN3
and a molecular weight of 297.79 g/mol. Its IUPAC name is 3-chloro-4-[5-[(2,4-dimethylphenyl)methyl]-1H-pyrazol-3-yl]pyridine.
Molecular Properties
| Compound Name | 3-chloro-4-[5-[(2,4-dimethylphenyl)methyl]-1H-pyrazol-3-yl]pyridine |
| PubChem CID | 69309763 |
| Molecular Formula | C17H16ClN3 |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 3-chloro-4-[5-[(2,4-dimethylphenyl)methyl]-1H-pyrazol-3-yl]pyridine |
| SMILES | Cc1ccc(Cc2cc(-c3ccncc3Cl)n[nH]2)c(C)c1 |
| InChI | InChI=1S/C17H16ClN3/c1-11-3-4-13(12(2)7-11)8-14-9-17(21-20-14)15-5-6-19-10-16(15)18/h3-7,9-10H,8H2,1-2H3,(H,20,21) |
| InChIKey | DSLHJEUCXUXETI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-4-[5-[(2,4-dimethylphenyl)methyl]-1H-pyrazol-3-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-[5-[(2,4-dimethylphenyl)methyl]-1H-pyrazol-3-yl]pyridine?
The IUPAC name of 3-chloro-4-[5-[(2,4-dimethylphenyl)methyl]-1H-pyrazol-3-yl]pyridine (CID 69309763) is 3-chloro-4-[5-[(2,4-dimethylphenyl)methyl]-1H-pyrazol-3-yl]pyridine.
What is the SMILES notation for 3-chloro-4-[5-[(2,4-dimethylphenyl)methyl]-1H-pyrazol-3-yl]pyridine?
The canonical SMILES for 3-chloro-4-[5-[(2,4-dimethylphenyl)methyl]-1H-pyrazol-3-yl]pyridine is Cc1ccc(Cc2cc(-c3ccncc3Cl)n[nH]2)c(C)c1.
What is the InChIKey of 3-chloro-4-[5-[(2,4-dimethylphenyl)methyl]-1H-pyrazol-3-yl]pyridine?
The InChIKey is DSLHJEUCXUXETI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClN3/c1-11-3-4-13(12(2)7-11)8-14-9-17(21-20-14)15-5-6-19-10-16(15)18/h3-7,9-10H,8H2,1-2H3,(H,20,21).
What are the key properties of 3-chloro-4-[5-[(2,4-dimethylphenyl)methyl]-1H-pyrazol-3-yl]pyridine?
3-chloro-4-[5-[(2,4-dimethylphenyl)methyl]-1H-pyrazol-3-yl]pyridine has a molecular weight of 297.79 g/mol, XLogP of 4.33, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-[5-[(2,4-dimethylphenyl)methyl]-1H-pyrazol-3-yl]pyridine is sourced from PubChem (CID 69309763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).