C32H47NO6S — CID 69310831
2-[6-[2-[(3-cyclopentylsulfinylphenyl)methoxy]ethoxy]hexylamino]-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)ethanol (PubChem CID 69310831) has the molecular formula C32H47NO6S and a molecular weight of 573.80 g/mol. Its IUPAC name is 2-[6-[2-[(3-cyclopentylsulfinylphenyl)methoxy]ethoxy]hexylamino]-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)ethanol.
| Compound Name | 2-[6-[2-[(3-cyclopentylsulfinylphenyl)methoxy]ethoxy]hexylamino]-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)ethanol |
|---|---|
| PubChem CID | 69310831 |
| Molecular Formula | C32H47NO6S |
| Molecular Weight | 573.80 g/mol |
| Exact Mass | 573.31 |
| IUPAC Name | 2-[6-[2-[(3-cyclopentylsulfinylphenyl)methoxy]ethoxy]hexylamino]-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)ethanol |
| SMILES | CC1(C)OCc2cc(C(CO)NCCCCCCOCCOCc3cccc(S(=O)C4CCCC4)c3)ccc2O1 |
| InChI | InChI=1S/C32H47NO6S/c1-32(2)38-24-27-21-26(14-15-31(27)39-32)30(22-34)33-16-7-3-4-8-17-36-18-19-37-23-25-10-9-13-29(20-25)40(35)28-11-5-6-12-28/h9-10,13-15,20-21,28,30,33-34H,3-8,11-12,16-19,22-24H2,1-2H3 |
| InChIKey | SUPLYNUISWECCW-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.80 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|