C23H24ClN5O2 — CID 69311096
N-[(1S)-3-amino-1-(6-chloro-1H-benzimidazol-2-yl)propyl]-4-(2,5-dihydropyrrole-1-carbonyl)-3-methylbenzamide (PubChem CID 69311096) has the molecular formula C23H24ClN5O2 and a molecular weight of 437.93 g/mol. Its IUPAC name is N-[(1S)-3-amino-1-(6-chloro-1H-benzimidazol-2-yl)propyl]-4-(2,5-dihydropyrrole-1-carbonyl)-3-methylbenzamide.
| Compound Name | N-[(1S)-3-amino-1-(6-chloro-1H-benzimidazol-2-yl)propyl]-4-(2,5-dihydropyrrole-1-carbonyl)-3-methylbenzamide |
|---|---|
| PubChem CID | 69311096 |
| Molecular Formula | C23H24ClN5O2 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | N-[(1S)-3-amino-1-(6-chloro-1H-benzimidazol-2-yl)propyl]-4-(2,5-dihydropyrrole-1-carbonyl)-3-methylbenzamide |
| SMILES | Cc1cc(C(=O)N[C@@H](CCN)c2nc3ccc(Cl)cc3[nH]2)ccc1C(=O)N1CC=CC1 |
| InChI | InChI=1S/C23H24ClN5O2/c1-14-12-15(4-6-17(14)23(31)29-10-2-3-11-29)22(30)28-19(8-9-25)21-26-18-7-5-16(24)13-20(18)27-21/h2-7,12-13,19H,8-11,25H2,1H3,(H,26,27)(H,28,30)/t19-/m0/s1 |
| InChIKey | IUEAVKHANNNBBY-IBGZPJMESA-N |
| XLogP | 3.36 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|