C19H24ClN3 — CID 69311132
1-[(2S,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl]-N-[(6-chloroquinolin-2-yl)methyl]methanamine (PubChem CID 69311132) has the molecular formula C19H24ClN3 and a molecular weight of 329.88 g/mol. Its IUPAC name is 1-[(2S,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl]-N-[(6-chloroquinolin-2-yl)methyl]methanamine.
| Compound Name | 1-[(2S,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl]-N-[(6-chloroquinolin-2-yl)methyl]methanamine |
|---|---|
| PubChem CID | 69311132 |
| Molecular Formula | C19H24ClN3 |
| Molecular Weight | 329.88 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 1-[(2S,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl]-N-[(6-chloroquinolin-2-yl)methyl]methanamine |
| SMILES | Clc1ccc2nc(CNC[C@@H]3C[C@@H]4CCCC[C@@H]4N3)ccc2c1 |
| InChI | InChI=1S/C19H24ClN3/c20-15-6-8-19-14(9-15)5-7-16(22-19)11-21-12-17-10-13-3-1-2-4-18(13)23-17/h5-9,13,17-18,21,23H,1-4,10-12H2/t13-,17-,18-/m0/s1 |
| InChIKey | UANLVAHLUSQVRD-KKXDTOCCSA-N |
| XLogP | 3.90 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.88 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |