About 2-amino-4,5-dimethoxybenzoate
2-amino-4,5-dimethoxybenzoate (PubChem CID 6931137) has the molecular formula C9H10NO4-
and a molecular weight of 196.18 g/mol. Its IUPAC name is 2-amino-4,5-dimethoxybenzoate.
Molecular Properties
| Compound Name | 2-amino-4,5-dimethoxybenzoate |
| PubChem CID | 6931137 |
| Molecular Formula | C9H10NO4- |
| Molecular Weight | 196.18 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 2-amino-4,5-dimethoxybenzoate |
| SMILES | COc1cc(N)c(C(=O)[O-])cc1OC |
| InChI | InChI=1S/C9H11NO4/c1-13-7-3-5(9(11)12)6(10)4-8(7)14-2/h3-4H,10H2,1-2H3,(H,11,12)/p-1 |
| InChIKey | HJVAVGOPTDJYOJ-UHFFFAOYSA-M |
| XLogP | -0.35 |
| TPSA | 84.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.18 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4,5-dimethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4,5-dimethoxybenzoate?
The IUPAC name of 2-amino-4,5-dimethoxybenzoate (CID 6931137) is 2-amino-4,5-dimethoxybenzoate.
What is the SMILES notation for 2-amino-4,5-dimethoxybenzoate?
The canonical SMILES for 2-amino-4,5-dimethoxybenzoate is COc1cc(N)c(C(=O)[O-])cc1OC.
What is the InChIKey of 2-amino-4,5-dimethoxybenzoate?
The InChIKey is HJVAVGOPTDJYOJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H11NO4/c1-13-7-3-5(9(11)12)6(10)4-8(7)14-2/h3-4H,10H2,1-2H3,(H,11,12)/p-1.
What are the key properties of 2-amino-4,5-dimethoxybenzoate?
2-amino-4,5-dimethoxybenzoate has a molecular weight of 196.18 g/mol, XLogP of -0.35, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4,5-dimethoxybenzoate is sourced from PubChem (CID 6931137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).