C17H23NO2 — CID 6931158
3,3,6,6-tetramethyl-2,4,5,7,8a,9-hexahydroacridine-1,8-dione (PubChem CID 6931158) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 3,3,6,6-tetramethyl-2,4,5,7,8a,9-hexahydroacridine-1,8-dione.
| Compound Name | 3,3,6,6-tetramethyl-2,4,5,7,8a,9-hexahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 6931158 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 3,3,6,6-tetramethyl-2,4,5,7,8a,9-hexahydroacridine-1,8-dione |
| SMILES | CC1(C)CC(=O)C2CC3=C(CC(C)(C)CC3=O)N=C2C1 |
| InChI | InChI=1S/C17H23NO2/c1-16(2)6-12-10(14(19)8-16)5-11-13(18-12)7-17(3,4)9-15(11)20/h10H,5-9H2,1-4H3 |
| InChIKey | WJQHMJFQUXFEIW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |