C23H19FN6O2 — CID 69311777
2-(6-fluorobenzimidazol-1-yl)-9-[(2R,4R)-2-phenyloxan-4-yl]-7H-purin-8-one (PubChem CID 69311777) has the molecular formula C23H19FN6O2 and a molecular weight of 430.44 g/mol. Its IUPAC name is 2-(6-fluorobenzimidazol-1-yl)-9-[(2R,4R)-2-phenyloxan-4-yl]-7H-purin-8-one.
| Compound Name | 2-(6-fluorobenzimidazol-1-yl)-9-[(2R,4R)-2-phenyloxan-4-yl]-7H-purin-8-one |
|---|---|
| PubChem CID | 69311777 |
| Molecular Formula | C23H19FN6O2 |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 2-(6-fluorobenzimidazol-1-yl)-9-[(2R,4R)-2-phenyloxan-4-yl]-7H-purin-8-one |
| SMILES | O=c1[nH]c2cnc(-n3cnc4ccc(F)cc43)nc2n1[C@@H]1CCO[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C23H19FN6O2/c24-15-6-7-17-19(10-15)29(13-26-17)22-25-12-18-21(28-22)30(23(31)27-18)16-8-9-32-20(11-16)14-4-2-1-3-5-14/h1-7,10,12-13,16,20H,8-9,11H2,(H,27,31)/t16-,20-/m1/s1 |
| InChIKey | WPMFPFMQCQFTPX-OXQOHEQNSA-N |
| XLogP | 3.69 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |