About [2-(3,4-difluorophenyl)phenyl]methylcarbamic acid
[2-(3,4-difluorophenyl)phenyl]methylcarbamic acid (PubChem CID 69312019) has the molecular formula C14H11F2NO2
and a molecular weight of 263.24 g/mol. Its IUPAC name is [2-(3,4-difluorophenyl)phenyl]methylcarbamic acid.
Molecular Properties
| Compound Name | [2-(3,4-difluorophenyl)phenyl]methylcarbamic acid |
| PubChem CID | 69312019 |
| Molecular Formula | C14H11F2NO2 |
| Molecular Weight | 263.24 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | [2-(3,4-difluorophenyl)phenyl]methylcarbamic acid |
| SMILES | O=C(O)NCc1ccccc1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H11F2NO2/c15-12-6-5-9(7-13(12)16)11-4-2-1-3-10(11)8-17-14(18)19/h1-7,17H,8H2,(H,18,19) |
| InChIKey | IGJNUKBZBYODAB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.24 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [2-(3,4-difluorophenyl)phenyl]methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,4-difluorophenyl)phenyl]methylcarbamic acid?
The IUPAC name of [2-(3,4-difluorophenyl)phenyl]methylcarbamic acid (CID 69312019) is [2-(3,4-difluorophenyl)phenyl]methylcarbamic acid.
What is the SMILES notation for [2-(3,4-difluorophenyl)phenyl]methylcarbamic acid?
The canonical SMILES for [2-(3,4-difluorophenyl)phenyl]methylcarbamic acid is O=C(O)NCc1ccccc1-c1ccc(F)c(F)c1.
What is the InChIKey of [2-(3,4-difluorophenyl)phenyl]methylcarbamic acid?
The InChIKey is IGJNUKBZBYODAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11F2NO2/c15-12-6-5-9(7-13(12)16)11-4-2-1-3-10(11)8-17-14(18)19/h1-7,17H,8H2,(H,18,19).
What are the key properties of [2-(3,4-difluorophenyl)phenyl]methylcarbamic acid?
[2-(3,4-difluorophenyl)phenyl]methylcarbamic acid has a molecular weight of 263.24 g/mol, XLogP of 3.40, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,4-difluorophenyl)phenyl]methylcarbamic acid is sourced from PubChem (CID 69312019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).