[2-(3,4-difluorophenyl)phenyl]methylcarbamic acid

C14H11F2NO2 — CID 69312019

IUPAC[2-(3,4-difluorophenyl)phenyl]methylcarbamic acid
SMILESO=C(O)NCc1ccccc1-c1ccc(F)c(F)c1
InChIInChI=1S/C14H11F2NO2/c15-12-6-5-9(7-13(12)16)11-4-2-1-3-10(11)8-17-14(18)19/h1-7,17H,8H2,(H,18,19)
InChIKeyIGJNUKBZBYODAB-UHFFFAOYSA-N
MW263.24 g/mol
LogP3.40
Rot. Bonds3

About [2-(3,4-difluorophenyl)phenyl]methylcarbamic acid

[2-(3,4-difluorophenyl)phenyl]methylcarbamic acid (PubChem CID 69312019) has the molecular formula C14H11F2NO2 and a molecular weight of 263.24 g/mol. Its IUPAC name is [2-(3,4-difluorophenyl)phenyl]methylcarbamic acid.

Molecular Properties

Compound Name[2-(3,4-difluorophenyl)phenyl]methylcarbamic acid
PubChem CID69312019
Molecular FormulaC14H11F2NO2
Molecular Weight263.24 g/mol
Exact Mass263.08
IUPAC Name[2-(3,4-difluorophenyl)phenyl]methylcarbamic acid
SMILESO=C(O)NCc1ccccc1-c1ccc(F)c(F)c1
InChIInChI=1S/C14H11F2NO2/c15-12-6-5-9(7-13(12)16)11-4-2-1-3-10(11)8-17-14(18)19/h1-7,17H,8H2,(H,18,19)
InChIKeyIGJNUKBZBYODAB-UHFFFAOYSA-N
XLogP3.40
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.24
LogP ≤ 53.40
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Analyze [2-(3,4-difluorophenyl)phenyl]methylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(3,4-difluorophenyl)phenyl]methylcarbamic acid?
The IUPAC name of [2-(3,4-difluorophenyl)phenyl]methylcarbamic acid (CID 69312019) is [2-(3,4-difluorophenyl)phenyl]methylcarbamic acid.
What is the SMILES notation for [2-(3,4-difluorophenyl)phenyl]methylcarbamic acid?
The canonical SMILES for [2-(3,4-difluorophenyl)phenyl]methylcarbamic acid is O=C(O)NCc1ccccc1-c1ccc(F)c(F)c1.
What is the InChIKey of [2-(3,4-difluorophenyl)phenyl]methylcarbamic acid?
The InChIKey is IGJNUKBZBYODAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11F2NO2/c15-12-6-5-9(7-13(12)16)11-4-2-1-3-10(11)8-17-14(18)19/h1-7,17H,8H2,(H,18,19).
What are the key properties of [2-(3,4-difluorophenyl)phenyl]methylcarbamic acid?
[2-(3,4-difluorophenyl)phenyl]methylcarbamic acid has a molecular weight of 263.24 g/mol, XLogP of 3.40, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,4-difluorophenyl)phenyl]methylcarbamic acid is sourced from PubChem (CID 69312019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).