C23H26F4N+ — CID 69312237
3-[2,2-bis(3,5-difluorophenyl)ethyl]-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane (PubChem CID 69312237) has the molecular formula C23H26F4N+ and a molecular weight of 392.46 g/mol. Its IUPAC name is 3-[2,2-bis(3,5-difluorophenyl)ethyl]-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane.
| Compound Name | 3-[2,2-bis(3,5-difluorophenyl)ethyl]-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 69312237 |
| Molecular Formula | C23H26F4N+ |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 3-[2,2-bis(3,5-difluorophenyl)ethyl]-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane |
| SMILES | C[N+]1(C)C2CCC1CC(CC(c1cc(F)cc(F)c1)c1cc(F)cc(F)c1)C2 |
| InChI | InChI=1S/C23H26F4N/c1-28(2)21-3-4-22(28)6-14(5-21)7-23(15-8-17(24)12-18(25)9-15)16-10-19(26)13-20(27)11-16/h8-14,21-23H,3-7H2,1-2H3/q+1 |
| InChIKey | YXZJMOFXUPQVSS-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|