About (1R,2S)-1,2-diphenylethane-1,2-diamine
(1R,2S)-1,2-diphenylethane-1,2-diamine (PubChem CID 6931234) has the molecular formula C14H16N2
and a molecular weight of 212.30 g/mol. Its IUPAC name is (1R,2S)-1,2-diphenylethane-1,2-diamine.
Molecular Properties
| Compound Name | (1R,2S)-1,2-diphenylethane-1,2-diamine |
| PubChem CID | 6931234 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (1R,2S)-1,2-diphenylethane-1,2-diamine |
| SMILES | N[C@H](c1ccccc1)[C@@H](N)c1ccccc1 |
| InChI | InChI=1S/C14H16N2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-14H,15-16H2/t13-,14+ |
| InChIKey | PONXTPCRRASWKW-OKILXGFUSA-N |
| XLogP | 2.39 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R,2S)-1,2-diphenylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2S)-1,2-diphenylethane-1,2-diamine?
The IUPAC name of (1R,2S)-1,2-diphenylethane-1,2-diamine (CID 6931234) is (1R,2S)-1,2-diphenylethane-1,2-diamine.
What is the SMILES notation for (1R,2S)-1,2-diphenylethane-1,2-diamine?
The canonical SMILES for (1R,2S)-1,2-diphenylethane-1,2-diamine is N[C@H](c1ccccc1)[C@@H](N)c1ccccc1.
What is the InChIKey of (1R,2S)-1,2-diphenylethane-1,2-diamine?
The InChIKey is PONXTPCRRASWKW-OKILXGFUSA-N. The full InChI is InChI=1S/C14H16N2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-14H,15-16H2/t13-,14+.
What are the key properties of (1R,2S)-1,2-diphenylethane-1,2-diamine?
(1R,2S)-1,2-diphenylethane-1,2-diamine has a molecular weight of 212.30 g/mol, XLogP of 2.39, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2S)-1,2-diphenylethane-1,2-diamine is sourced from PubChem (CID 6931234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).