C15H19N3O2 — CID 6931256
N-(2,3-dihydro-1H-inden-2-yl)-2-[(2S)-3-oxopiperazin-2-yl]acetamide (PubChem CID 6931256) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-2-yl)-2-[(2S)-3-oxopiperazin-2-yl]acetamide.
| Compound Name | N-(2,3-dihydro-1H-inden-2-yl)-2-[(2S)-3-oxopiperazin-2-yl]acetamide |
|---|---|
| PubChem CID | 6931256 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-2-yl)-2-[(2S)-3-oxopiperazin-2-yl]acetamide |
| SMILES | O=C(C[C@@H]1NCCNC1=O)NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C15H19N3O2/c19-14(9-13-15(20)17-6-5-16-13)18-12-7-10-3-1-2-4-11(10)8-12/h1-4,12-13,16H,5-9H2,(H,17,20)(H,18,19)/t13-/m0/s1 |
| InChIKey | WCERIWWJONMSNY-ZDUSSCGKSA-N |
| XLogP | -0.25 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |