C17H22F2N2O5 — CID 69313146
3-[4-(3,3-difluoro-4,4-dimethoxypiperidin-1-yl)phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one (PubChem CID 69313146) has the molecular formula C17H22F2N2O5 and a molecular weight of 372.37 g/mol. Its IUPAC name is 3-[4-(3,3-difluoro-4,4-dimethoxypiperidin-1-yl)phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-[4-(3,3-difluoro-4,4-dimethoxypiperidin-1-yl)phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 69313146 |
| Molecular Formula | C17H22F2N2O5 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 3-[4-(3,3-difluoro-4,4-dimethoxypiperidin-1-yl)phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
| SMILES | COC1(OC)CCN(c2ccc(N3CC(CO)OC3=O)cc2)CC1(F)F |
| InChI | InChI=1S/C17H22F2N2O5/c1-24-17(25-2)7-8-20(11-16(17,18)19)12-3-5-13(6-4-12)21-9-14(10-22)26-15(21)23/h3-6,14,22H,7-11H2,1-2H3 |
| InChIKey | SMNRLIQGLIGOIX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|