C19H21NO — CID 69314950
N-methyl-1-[(2R,4S,6S)-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaen-4-yl]methanamine (PubChem CID 69314950) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is N-methyl-1-[(2R,4S,6S)-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaen-4-yl]methanamine.
| Compound Name | N-methyl-1-[(2R,4S,6S)-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaen-4-yl]methanamine |
|---|---|
| PubChem CID | 69314950 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N-methyl-1-[(2R,4S,6S)-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaen-4-yl]methanamine |
| SMILES | CNC[C@@H]1C[C@H]2c3ccccc3Cc3ccccc3[C@@H]2O1 |
| InChI | InChI=1S/C19H21NO/c1-20-12-15-11-18-16-8-4-2-6-13(16)10-14-7-3-5-9-17(14)19(18)21-15/h2-9,15,18-20H,10-12H2,1H3/t15-,18-,19-/m0/s1 |
| InChIKey | RUKTXHCGSFMYLO-SNRMKQJTSA-N |
| XLogP | 3.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |