C22H23N5O3S — CID 69315071
5-[4-(2,3-dihydro-1H-indole-3-carbonyl)anilino]-N'-(1-hydroxypropan-2-yl)-3-oxo-1,2-thiazole-4-carboximidamide (PubChem CID 69315071) has the molecular formula C22H23N5O3S and a molecular weight of 437.53 g/mol. Its IUPAC name is 5-[4-(2,3-dihydro-1H-indole-3-carbonyl)anilino]-N'-(1-hydroxypropan-2-yl)-3-oxo-1,2-thiazole-4-carboximidamide.
| Compound Name | 5-[4-(2,3-dihydro-1H-indole-3-carbonyl)anilino]-N'-(1-hydroxypropan-2-yl)-3-oxo-1,2-thiazole-4-carboximidamide |
|---|---|
| PubChem CID | 69315071 |
| Molecular Formula | C22H23N5O3S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 5-[4-(2,3-dihydro-1H-indole-3-carbonyl)anilino]-N'-(1-hydroxypropan-2-yl)-3-oxo-1,2-thiazole-4-carboximidamide |
| SMILES | CC(CO)/N=C(\N)c1c(Nc2ccc(C(=O)C3CNc4ccccc43)cc2)s[nH]c1=O |
| InChI | InChI=1S/C22H23N5O3S/c1-12(11-28)25-20(23)18-21(30)27-31-22(18)26-14-8-6-13(7-9-14)19(29)16-10-24-17-5-3-2-4-15(16)17/h2-9,12,16,24,26,28H,10-11H2,1H3,(H2,23,25)(H,27,30) |
| InChIKey | DCAVDTJZNNHZLN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 132.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|