C23H18N8OS — CID 69315821
N-[(1S)-1-[3-(12-methyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,10-pentaen-4-yl)phenyl]ethyl]-2H-benzotriazole-5-carboxamide (PubChem CID 69315821) has the molecular formula C23H18N8OS and a molecular weight of 454.52 g/mol. Its IUPAC name is N-[(1S)-1-[3-(12-methyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,10-pentaen-4-yl)phenyl]ethyl]-2H-benzotriazole-5-carboxamide.
| Compound Name | N-[(1S)-1-[3-(12-methyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,10-pentaen-4-yl)phenyl]ethyl]-2H-benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 69315821 |
| Molecular Formula | C23H18N8OS |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | N-[(1S)-1-[3-(12-methyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,10-pentaen-4-yl)phenyl]ethyl]-2H-benzotriazole-5-carboxamide |
| SMILES | C[C@H](NC(=O)c1ccc2n[nH]nc2c1)c1cccc(-c2nc3c(ncc4ncn(C)c43)s2)c1 |
| InChI | InChI=1S/C23H18N8OS/c1-12(26-21(32)14-6-7-16-17(9-14)29-30-28-16)13-4-3-5-15(8-13)22-27-19-20-18(25-11-31(20)2)10-24-23(19)33-22/h3-12H,1-2H3,(H,26,32)(H,28,29,30)/t12-/m0/s1 |
| InChIKey | MYHIENRCNMOASP-LBPRGKRZSA-N |
| XLogP | 4.01 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |