About (6S)-2-ethenyl-4,4,6-trimethyl-5,6-dihydro-1,3-oxazine
(6S)-2-ethenyl-4,4,6-trimethyl-5,6-dihydro-1,3-oxazine (PubChem CID 6931650) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is (6S)-2-ethenyl-4,4,6-trimethyl-5,6-dihydro-1,3-oxazine.
Analyze (6S)-2-ethenyl-4,4,6-trimethyl-5,6-dihydro-1,3-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-2-ethenyl-4,4,6-trimethyl-5,6-dihydro-1,3-oxazine?
The IUPAC name of (6S)-2-ethenyl-4,4,6-trimethyl-5,6-dihydro-1,3-oxazine (CID 6931650) is (6S)-2-ethenyl-4,4,6-trimethyl-5,6-dihydro-1,3-oxazine.
What is the SMILES notation for (6S)-2-ethenyl-4,4,6-trimethyl-5,6-dihydro-1,3-oxazine?
The canonical SMILES for (6S)-2-ethenyl-4,4,6-trimethyl-5,6-dihydro-1,3-oxazine is C=CC1=NC(C)(C)C[C@H](C)O1.
What is the InChIKey of (6S)-2-ethenyl-4,4,6-trimethyl-5,6-dihydro-1,3-oxazine?
The InChIKey is JMQHTHXKRALUHF-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H15NO/c1-5-8-10-9(3,4)6-7(2)11-8/h5,7H,1,6H2,2-4H3/t7-/m0/s1.
What are the key properties of (6S)-2-ethenyl-4,4,6-trimethyl-5,6-dihydro-1,3-oxazine?
(6S)-2-ethenyl-4,4,6-trimethyl-5,6-dihydro-1,3-oxazine has a molecular weight of 153.22 g/mol, XLogP of 2.16, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-2-ethenyl-4,4,6-trimethyl-5,6-dihydro-1,3-oxazine is sourced from PubChem (CID 6931650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).