(2S)-2-formamido-3,3-dimethylbutanoic acid

C7H13NO3 — CID 6931667

IUPAC(2S)-2-formamido-3,3-dimethylbutanoic acid
SMILESCC(C)(C)[C@H](NC=O)C(=O)O
InChIInChI=1S/C7H13NO3/c1-7(2,3)5(6(10)11)8-4-9/h4-5H,1-3H3,(H,8,9)(H,10,11)/t5-/m1/s1
InChIKeyWVCGTXBZDLZEDU-RXMQYKEDSA-N
MW159.18 g/mol
LogP0.23
Rot. Bonds3

About (2S)-2-formamido-3,3-dimethylbutanoic acid

(2S)-2-formamido-3,3-dimethylbutanoic acid (PubChem CID 6931667) has the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. Its IUPAC name is (2S)-2-formamido-3,3-dimethylbutanoic acid.

Molecular Properties

Compound Name(2S)-2-formamido-3,3-dimethylbutanoic acid
PubChem CID6931667
Molecular FormulaC7H13NO3
Molecular Weight159.18 g/mol
Exact Mass159.09
IUPAC Name(2S)-2-formamido-3,3-dimethylbutanoic acid
SMILESCC(C)(C)[C@H](NC=O)C(=O)O
InChIInChI=1S/C7H13NO3/c1-7(2,3)5(6(10)11)8-4-9/h4-5H,1-3H3,(H,8,9)(H,10,11)/t5-/m1/s1
InChIKeyWVCGTXBZDLZEDU-RXMQYKEDSA-N
XLogP0.23
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500159.18
LogP ≤ 50.23
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze (2S)-2-formamido-3,3-dimethylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-formamido-3,3-dimethylbutanoic acid?
The IUPAC name of (2S)-2-formamido-3,3-dimethylbutanoic acid (CID 6931667) is (2S)-2-formamido-3,3-dimethylbutanoic acid.
What is the SMILES notation for (2S)-2-formamido-3,3-dimethylbutanoic acid?
The canonical SMILES for (2S)-2-formamido-3,3-dimethylbutanoic acid is CC(C)(C)[C@H](NC=O)C(=O)O.
What is the InChIKey of (2S)-2-formamido-3,3-dimethylbutanoic acid?
The InChIKey is WVCGTXBZDLZEDU-RXMQYKEDSA-N. The full InChI is InChI=1S/C7H13NO3/c1-7(2,3)5(6(10)11)8-4-9/h4-5H,1-3H3,(H,8,9)(H,10,11)/t5-/m1/s1.
What are the key properties of (2S)-2-formamido-3,3-dimethylbutanoic acid?
(2S)-2-formamido-3,3-dimethylbutanoic acid has a molecular weight of 159.18 g/mol, XLogP of 0.23, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-formamido-3,3-dimethylbutanoic acid is sourced from PubChem (CID 6931667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).