About 2-(1H-azepin-2-yl)-1H-1,3-diazepine
2-(1H-azepin-2-yl)-1H-1,3-diazepine (PubChem CID 69317110) has the molecular formula C11H11N3
and a molecular weight of 185.23 g/mol. Its IUPAC name is 2-(1H-azepin-2-yl)-1H-1,3-diazepine.
Molecular Properties
| Compound Name | 2-(1H-azepin-2-yl)-1H-1,3-diazepine |
| PubChem CID | 69317110 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 2-(1H-azepin-2-yl)-1H-1,3-diazepine |
| SMILES | C1=CC=C(C2=NC=CC=CN2)NC=C1 |
| InChI | InChI=1S/C11H11N3/c1-2-6-10(12-7-3-1)11-13-8-4-5-9-14-11/h1-9,12H,(H,13,14) |
| InChIKey | PIPLEBKDXFFIRQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1H-azepin-2-yl)-1H-1,3-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-azepin-2-yl)-1H-1,3-diazepine?
The IUPAC name of 2-(1H-azepin-2-yl)-1H-1,3-diazepine (CID 69317110) is 2-(1H-azepin-2-yl)-1H-1,3-diazepine.
What is the SMILES notation for 2-(1H-azepin-2-yl)-1H-1,3-diazepine?
The canonical SMILES for 2-(1H-azepin-2-yl)-1H-1,3-diazepine is C1=CC=C(C2=NC=CC=CN2)NC=C1.
What is the InChIKey of 2-(1H-azepin-2-yl)-1H-1,3-diazepine?
The InChIKey is PIPLEBKDXFFIRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3/c1-2-6-10(12-7-3-1)11-13-8-4-5-9-14-11/h1-9,12H,(H,13,14).
What are the key properties of 2-(1H-azepin-2-yl)-1H-1,3-diazepine?
2-(1H-azepin-2-yl)-1H-1,3-diazepine has a molecular weight of 185.23 g/mol, XLogP of 1.57, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-azepin-2-yl)-1H-1,3-diazepine is sourced from PubChem (CID 69317110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).