C19H20Br2N2O6S — CID 69317762
3-[3,5-dibromo-4-[[3-(ethylsulfonylamino)-5-methylphenyl]methoxy]anilino]-3-oxopropanoic acid (PubChem CID 69317762) has the molecular formula C19H20Br2N2O6S and a molecular weight of 564.25 g/mol. Its IUPAC name is 3-[3,5-dibromo-4-[[3-(ethylsulfonylamino)-5-methylphenyl]methoxy]anilino]-3-oxopropanoic acid.
| Compound Name | 3-[3,5-dibromo-4-[[3-(ethylsulfonylamino)-5-methylphenyl]methoxy]anilino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 69317762 |
| Molecular Formula | C19H20Br2N2O6S |
| Molecular Weight | 564.25 g/mol |
| Exact Mass | 561.94 |
| IUPAC Name | 3-[3,5-dibromo-4-[[3-(ethylsulfonylamino)-5-methylphenyl]methoxy]anilino]-3-oxopropanoic acid |
| SMILES | CCS(=O)(=O)Nc1cc(C)cc(COc2c(Br)cc(NC(=O)CC(=O)O)cc2Br)c1 |
| InChI | InChI=1S/C19H20Br2N2O6S/c1-3-30(27,28)23-14-5-11(2)4-12(6-14)10-29-19-15(20)7-13(8-16(19)21)22-17(24)9-18(25)26/h4-8,23H,3,9-10H2,1-2H3,(H,22,24)(H,25,26) |
| InChIKey | HQCVUQGCSSNVQW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.25 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|